|
Comment: SENS-111 (Seliforant) is an orally available small molecule histamine type 4 receptor antagonist, displaying an inhibitory effect on vestibular neuron activity.
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
5
|
|
Hydrogen bond donors
|
2
|
|
Rotatable bonds
|
4
|
|
Topological polar surface area
|
67.07
|
|
Molecular weight
|
235.18
|
|
XLogP
|
1.78
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CNC1CN(C1)c1cc(N)nc(n1)CC(C)C
|
|
Isomeric SMILES
|
CNC1CN(C1)c1cc(N)nc(n1)CC(C)C
|
|
InChI
|
InChI=1S/C12H21N5/c1-8(2)4-11-15-10(13)5-12(16-11)17-6-9(7-17)14-3/h5,8-9,14H,4,6-7H2,1-3H3,(H2,13,15,16)
|
|
InChI Key
|
QRBVUFXEMHNIDB-UHFFFAOYSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|