Compound class:
Natural product
Comment: Orthosteric agonist of GPR84.
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
4
|
|
Hydrogen bond donors
|
2
|
|
Rotatable bonds
|
10
|
|
Topological polar surface area
|
74.6
|
|
Molecular weight
|
294.18
|
|
XLogP
|
6.23
|
|
No. Lipinski's rules broken
|
1
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CCCCCCCCCCCC1=C(O)C(=O)C=C(C1=O)O
|
|
Isomeric SMILES
|
CCCCCCCCCCCC1=C(O)C(=O)C=C(C1=O)O
|
|
InChI
|
InChI=1S/C17H26O4/c1-2-3-4-5-6-7-8-9-10-11-13-16(20)14(18)12-15(19)17(13)21/h12,18,21H,2-11H2,1H3
|
|
InChI Key
|
IRSFLDGTOHBADP-UHFFFAOYSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|