|
Synonyms: [3H]-SSR149415 | [3H]SSR149415
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
8
|
|
Hydrogen bond donors
|
1
|
|
Rotatable bonds
|
9
|
|
Topological polar surface area
|
134.3
|
|
Molecular weight
|
629.16
|
|
XLogP
|
2.77
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
COc1cc(OC)ccc1S(=O)(=O)N1c2ccc(cc2C(C1=O)(N1CC(CC1C(=O)N(C)C)O)c1ccccc1OC)Cl
|
|
Isomeric SMILES
|
COc1ccccc1[C@]1(N2C[C@@H](C[C@H]2C(=O)N(C)C)O)c2cc(Cl)ccc2N(C1=O)S(=O)(=O)c1ccc(cc1OC([3H])([3H])[3H])OC([3H])([3H])[3H]
|
|
InChI
|
InChI=1S/C30H32ClN3O8S/c1-32(2)28(36)24-15-19(35)17-33(24)30(21-8-6-7-9-25(21)41-4)22-14-18(31)10-12-23(22)34(29(30)37)43(38,39)27-13-11-20(40-3)16-26(27)42-5/h6-14,16,19,24,35H,15,17H2,1-5H3/t19-,24+,30+/m1/s1/i3T3,5T3
|
|
InChI Key
|
NJXZWIIMWNEOGJ-KGKCFUOPSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|