|
Synonyms: adenosine- 3', 5'- cyclic monophosphorothioate, Rp- isomer
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
9
|
|
Hydrogen bond donors
|
3
|
|
Rotatable bonds
|
1
|
|
Topological polar surface area
|
179.67
|
|
Molecular weight
|
345.03
|
|
XLogP
|
-0.54
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
OC1C2OP(=S)(O)OCC2OC1n1cnc2c1ncnc2N
|
|
Isomeric SMILES
|
O[C@@H]1[C@@H]2O[P@@](=S)(O)OC[C@H]2O[C@H]1n1cnc2c1ncnc2N
|
|
InChI
|
InChI=1S/C10H12N5O5PS/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(19-10)1-18-21(17,22)20-7/h2-4,6-7,10,16H,1H2,(H,17,22)(H2,11,12,13)/t4-,6-,7-,10-,21-/m1/s1
|
|
InChI Key
|
SMPNJFHAPJOHPP-PUHOFUEYSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|