|
Synonyms: N-dihomo-γ -linolenoylethanolamine
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
3
|
|
Hydrogen bond donors
|
2
|
|
Rotatable bonds
|
18
|
|
Topological polar surface area
|
49.33
|
|
Molecular weight
|
349.3
|
|
XLogP
|
7.76
|
|
No. Lipinski's rules broken
|
2
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CCCCCC=CCC=CCC=CCCCCCCC(=O)NCCO
|
|
Isomeric SMILES
|
CCCCC/C=C\C/C=C\C/C=C\CCCCCCC(=O)NCCO
|
|
InChI
|
InChI=1S/C22H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h6-7,9-10,12-13,24H,2-5,8,11,14-21H2,1H3,(H,23,25)/b7-6-,10-9-,13-12-
|
|
InChI Key
|
ULQWKETUACYZLI-QNEBEIHSSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|