|
Compound class:
Metabolite
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
1
|
|
Hydrogen bond donors
|
0
|
|
Rotatable bonds
|
1
|
|
Topological polar surface area
|
3.24
|
|
Molecular weight
|
73.09
|
|
XLogP
|
0.49
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CCN(C)C
|
|
Isomeric SMILES
|
CCN(C)C
|
|
InChI
|
InChI=1S/C4H11N/c1-4-5(2)3/h4H2,1-3H3
|
|
InChI Key
|
DAZXVJBJRMWXJP-UHFFFAOYSA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|