|
Comment: Compound 20 is a PROTAC that targets receptor-interacting serine/threonine protein kinase 2 (RIPK2) for degradation [ 1]. It promotes RIPK2 degradation by promoting the formation of a ternary complex between an E3 ligase (in this case an inhibitor of apoptosis (IAP) E3 ligase) and the target protein. Compound 20 inhibits TNFα release which is indicative of inhibition of RIPK2-induced transcriptional activation of inflammatory cytokine genes.
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
19
|
|
Hydrogen bond donors
|
6
|
|
Rotatable bonds
|
23
|
|
Topological polar surface area
|
270.14
|
|
Molecular weight
|
1044.49
|
|
XLogP
|
4.43
|
|
No. Lipinski's rules broken
|
3
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
CN[C@H](C(=O)N[C@@H](C(C)(C)C)C(=O)N1C[C@H](C[C@H]1C(=O)Nc1c(F)cccc1F)NC(=O)c1ncc(nc1)N1CCN(CC1)CCCOc1cc2ncnc(c2cc1S(=O)(=O)C(C)(C)C)Nc1n[nH]c(c1C)C)C
|
|
Isomeric SMILES
|
CN[C@@H](C)C(=O)N[C@H](C(=O)N1C[C@H](C[C@H]1C(=O)Nc1c(F)cccc1F)NC(=O)c1cnc(cn1)N1CCN(CCCOc2cc3ncnc(Nc4n[nH]c(C)c4C)c3cc2S(=O)(=O)C(C)(C)C)CC1)C(C)(C)C
|
|
InChI
|
InChI=1S/C50H66F2N14O7S/c1-28-29(2)62-63-43(28)61-44-32-22-39(74(71,72)50(7,8)9)38(23-35(32)56-27-57-44)73-20-12-15-64-16-18-65(19-17-64)40-25-54-36(24-55-40)46(68)58-31-21-37(47(69)59-41-33(51)13-11-14-34(41)52)66(26-31)48(70)42(49(4,5)6)60-45(67)30(3)53-10/h11,13-14,22-25,27,30-31,37,42,53H,12,15-21,26H2,1-10H3,(H,58,68)(H,59,69)(H,60,67)(H2,56,57,61,62,63)/t30-,31-,37-,42+/m0/s1
|
|
InChI Key
|
CHNBEZLJAQUZEX-LFRONEFISA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|