|
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
6
|
|
Hydrogen bond donors
|
4
|
|
Rotatable bonds
|
4
|
|
Topological polar surface area
|
130.66
|
|
Molecular weight
|
183.03
|
|
XLogP
|
-4.42
|
|
No. Lipinski's rules broken
|
0
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
OC(=O)C(CCP(=O)(O)O)N
|
|
Isomeric SMILES
|
OC(=O)[C@H](CCP(=O)(O)O)N
|
|
InChI
|
InChI=1S/C4H10NO5P/c5-3(4(6)7)1-2-11(8,9)10/h3H,1-2,5H2,(H,6,7)(H2,8,9,10)/t3-/m0/s1
|
|
InChI Key
|
DDOQBQRIEWHWBT-VKHMYHEASA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|