| 
                                                                Synonyms: mikamycin B | ostreogrycin B | Pyostacine® | streptogramin B | virginiamycin B
                                 pristinamycin IA is an approved drug (France, 1995) Compound class: 
                                                            Natural product
                                 
                                    
                                        Comment: Pristinamycin IA is a cyclic depsipeptide that is, together with pristinamycin IIA , a component of pristinamycin (PubChem CID 11979535 ), a streptogramin antibacterial produced by Streptomyces pristinaespiralis  [1 ]. Note that the INN describes the mixture.
                                    
                                 |  | 
                                                
                                        
                                           
                                                
                                                    | 2D Structure   
                                                                    |  
                                                    |   |  
                                                    | Physico-chemical Properties   
                                                                    |  |  
                                                        | 
                                                    
                                                        | Hydrogen bond acceptors | 18 |  
                                                        | Hydrogen bond donors | 4 |  
                                                        | Rotatable bonds | 8 |  
                                                        | Topological polar surface area | 227.43 |  
                                                        | Molecular weight | 866.96 |  
                                                        | XLogP | 0.9 |  
                                                        | No. Lipinski's rules broken | 2 |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  
                                                    | SMILES / InChI / InChIKey   
                                                                    |  |  
                                                        | 
                                                              
                                                                  
                                                            | Canonical SMILES | CC[C@@H]1C(=O)N2CCC[C@H]2C(=O)N(C)[C@@H](CC3=CC=C(C=C3)N(C)C)C(=O)N4CCC(=O)C[C@H]4C(=O)N[C@@H](C5=CC=CC=C5)C(=O)O[C@H](C)[C@@H](C(=O)N1)NC(=O)C6=NC=CC=C6O |  
                                                            | Isomeric SMILES | CC[C@@H]1C(=O)N2CCC[C@H]2C(=O)N([C@H](C(=O)N3CCC(=O)C[C@H]3C(=O)N[C@H](C(=O)O[C@@H]([C@@H](C(=O)N1)NC(=O)C4=C(C=CC=N4)O)C)C5=CC=CC=C5)CC6=CC=C(C=C6)N(C)C)C |  
                                                            | InChI | InChI=1S/C45H54N8O10/c1-6-31-42(59)52-22-11-14-32(52)43(60)51(5)34(24-27-16-18-29(19-17-27)50(3)4)44(61)53-23-20-30(54)25-33(53)39(56)49-37(28-12-8-7-9-13-28)45(62)63-26(2)36(40(57)47-31)48-41(58)38-35(55)15-10-21-46-38/h7-10,12-13,15-19,21,26,31-34,36-37,55H,6,11,14,20,22-25H2,1-5H3,(H,47,57)(H,48,58)(H,49,56)/t26-,31-,32+,33+,34+,36+,37+/m1/s1 |  
                                                            | InChI Key | YGXCETJZBDTKRY-DZCVGBHJSA-N |  Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/) |  |