|
Synonyms: 5,6-dihydro-4,5-didehydro-11-deoxy-11-oxa-16-(3-chlorophenoxy)-ω-tetranor-PGF2α | AL-12180
|
|
2D Structure
|
|
Physico-chemical Properties
|
|
|
Hydrogen bond acceptors
|
5
|
|
Hydrogen bond donors
|
3
|
|
Rotatable bonds
|
11
|
|
Topological polar surface area
|
96.22
|
|
Molecular weight
|
410.15
|
|
XLogP
|
3.26
|
|
No. Lipinski's rules broken
|
1
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
SMILES / InChI / InChIKey
|
|
|
Canonical SMILES
|
OC(=O)CCC=CCCC1C(C=CC(COc2cccc(c2)Cl)O)OCC1O
|
|
Isomeric SMILES
|
OC(=O)CC/C=C\CC[C@@H]1[C@@H](/C=C/[C@H](COc2cccc(c2)Cl)O)OC[C@@H]1O
|
|
InChI
|
InChI=1S/C21H27ClO6/c22-15-6-5-7-17(12-15)27-13-16(23)10-11-20-18(19(24)14-28-20)8-3-1-2-4-9-21(25)26/h1-2,5-7,10-12,16,18-20,23-24H,3-4,8-9,13-14H2,(H,25,26)/b2-1-,11-10+/t16-,18+,19+,20-/m1/s1
|
|
InChI Key
|
GLYAVTUPQOQHAD-MOBTWWNESA-N
|
Generated using the Chemistry Development Kit (CDK) (Willighagen EL et al. Journal of Cheminformatics vol. 9:33. 2017, doi:10.1186/s13321-017-0220-4; https://cdk.github.io/)
|
|